C20H30ClN3O2S — CID 119309691
N-[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperidin-4-yl]-5-methylthiophene-2-carboxamide;hydrochloride (PubChem CID 119309691) has the molecular formula C20H30ClN3O2S and a molecular weight of 412.00 g/mol. Its IUPAC name is N-[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperidin-4-yl]-5-methylthiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperidin-4-yl]-5-methylthiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119309691 |
| Molecular Formula | C20H30ClN3O2S |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperidin-4-yl]-5-methylthiophene-2-carboxamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=O)C3CC4CCCCC4N3)CC2)s1.Cl |
| InChI | InChI=1S/C20H29N3O2S.ClH/c1-13-6-7-18(26-13)19(24)21-15-8-10-23(11-9-15)20(25)17-12-14-4-2-3-5-16(14)22-17;/h6-7,14-17,22H,2-5,8-12H2,1H3,(H,21,24);1H |
| InChIKey | KCOPWZCHWKLVNA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |