C15H18ClN3O3S — CID 119311147
N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119311147) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119311147 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(CN2C(=O)CSC2=O)cc1)C1CCCN1 |
| InChI | InChI=1S/C15H17N3O3S.ClH/c19-13-9-22-15(21)18(13)8-10-3-5-11(6-4-10)17-14(20)12-2-1-7-16-12;/h3-6,12,16H,1-2,7-9H2,(H,17,20);1H |
| InChIKey | JPAFOHIQMJZTEQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|