C15H19N5O — CID 119311516
N-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]piperidine-3-carboxamide (PubChem CID 119311516) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | N-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119311516 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[4-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]piperidine-3-carboxamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)C3CCCNC3)cc2)n[nH]1 |
| InChI | InChI=1S/C15H19N5O/c1-10-17-14(20-19-10)11-4-6-13(7-5-11)18-15(21)12-3-2-8-16-9-12/h4-7,12,16H,2-3,8-9H2,1H3,(H,18,21)(H,17,19,20) |
| InChIKey | ILNIHOHHTMYPKZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |