C13H17BrClFN2O — CID 119312640
(2S)-N-[(5-bromo-2-fluorophenyl)methyl]-N-methylpyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119312640) has the molecular formula C13H17BrClFN2O and a molecular weight of 351.65 g/mol. Its IUPAC name is (2S)-N-[(5-bromo-2-fluorophenyl)methyl]-N-methylpyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-[(5-bromo-2-fluorophenyl)methyl]-N-methylpyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119312640 |
| Molecular Formula | C13H17BrClFN2O |
| Molecular Weight | 351.65 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | (2S)-N-[(5-bromo-2-fluorophenyl)methyl]-N-methylpyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CN(Cc1cc(Br)ccc1F)C(=O)[C@@H]1CCCN1.Cl |
| InChI | InChI=1S/C13H16BrFN2O.ClH/c1-17(13(18)12-3-2-6-16-12)8-9-7-10(14)4-5-11(9)15;/h4-5,7,12,16H,2-3,6,8H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | VBEXYABAMMFYQR-YDALLXLXSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.65 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |