C23H35N3O3S — CID 11931297
2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 11931297) has the molecular formula C23H35N3O3S and a molecular weight of 433.62 g/mol. Its IUPAC name is 2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 11931297 |
| Molecular Formula | C23H35N3O3S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)CN1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C23H35N3O3S/c1-18-11-12-20(30(28,29)26-14-5-2-6-15-26)16-21(18)24-23(27)17-25-13-7-9-19-8-3-4-10-22(19)25/h11-12,16,19,22H,2-10,13-15,17H2,1H3,(H,24,27)/t19-,22-/m0/s1 |
| InChIKey | UMQHCNOWZVHPEZ-UGKGYDQZSA-N |
| XLogP | 3.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |