C17H29N3O — CID 11931355
2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-[(2R)-2-cyano-3-methylbutan-2-yl]acetamide (PubChem CID 11931355) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-[(2R)-2-cyano-3-methylbutan-2-yl]acetamide.
| Compound Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-[(2R)-2-cyano-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 11931355 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-[(2R)-2-cyano-3-methylbutan-2-yl]acetamide |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)CN1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C17H29N3O/c1-13(2)17(3,12-18)19-16(21)11-20-10-6-8-14-7-4-5-9-15(14)20/h13-15H,4-11H2,1-3H3,(H,19,21)/t14-,15+,17+/m1/s1 |
| InChIKey | LNFLZOBBLGMJRL-VYDXJSESSA-N |
| XLogP | 2.70 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |