C14H17FN6O — CID 119313677
N-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]piperidine-2-carboxamide (PubChem CID 119313677) has the molecular formula C14H17FN6O and a molecular weight of 304.33 g/mol. Its IUPAC name is N-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]piperidine-2-carboxamide.
| Compound Name | N-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119313677 |
| Molecular Formula | C14H17FN6O |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[4-fluoro-3-(5-methyltetrazol-1-yl)phenyl]piperidine-2-carboxamide |
| SMILES | Cc1nnnn1-c1cc(NC(=O)C2CCCCN2)ccc1F |
| InChI | InChI=1S/C14H17FN6O/c1-9-18-19-20-21(9)13-8-10(5-6-11(13)15)17-14(22)12-4-2-3-7-16-12/h5-6,8,12,16H,2-4,7H2,1H3,(H,17,22) |
| InChIKey | NHSROUGKRDPMMX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |