C17H24Cl2N2O — CID 119315664
1-amino-N-[[1-(4-chlorophenyl)cyclobutyl]methyl]cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119315664) has the molecular formula C17H24Cl2N2O and a molecular weight of 343.30 g/mol. Its IUPAC name is 1-amino-N-[[1-(4-chlorophenyl)cyclobutyl]methyl]cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-[[1-(4-chlorophenyl)cyclobutyl]methyl]cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119315664 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-amino-N-[[1-(4-chlorophenyl)cyclobutyl]methyl]cyclopentane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1(C(=O)NCC2(c3ccc(Cl)cc3)CCC2)CCCC1 |
| InChI | InChI=1S/C17H23ClN2O.ClH/c18-14-6-4-13(5-7-14)16(8-3-9-16)12-20-15(21)17(19)10-1-2-11-17;/h4-7H,1-3,8-12,19H2,(H,20,21);1H |
| InChIKey | FVUCOESOTZIESP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |