C19H21F3N2O — CID 119316502
4-(aminomethyl)-N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]benzamide (PubChem CID 119316502) has the molecular formula C19H21F3N2O and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]benzamide.
| Compound Name | 4-(aminomethyl)-N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]benzamide |
|---|---|
| PubChem CID | 119316502 |
| Molecular Formula | C19H21F3N2O |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4-(aminomethyl)-N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]benzamide |
| SMILES | CC(C)(CNC(=O)c1ccc(CN)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N2O/c1-18(2,15-4-3-5-16(10-15)19(20,21)22)12-24-17(25)14-8-6-13(11-23)7-9-14/h3-10H,11-12,23H2,1-2H3,(H,24,25) |
| InChIKey | VPMDHAHBTPRRKJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |