C21H29N4O3+ — CID 11931805
2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide (PubChem CID 11931805) has the molecular formula C21H29N4O3+ and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide.
| Compound Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 11931805 |
| Molecular Formula | C21H29N4O3+ |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(NC(=O)C[NH+]2CC[C@@H]3CCCC[C@@H]3C2)C1=O |
| InChI | InChI=1S/C21H28N4O3/c1-21(17-9-3-2-4-10-17)19(27)25(20(28)22-21)23-18(26)14-24-12-11-15-7-5-6-8-16(15)13-24/h2-4,9-10,15-16H,5-8,11-14H2,1H3,(H,22,28)(H,23,26)/p+1/t15-,16+,21-/m0/s1 |
| InChIKey | QJBQJWBOJIHGKF-MRUHUIDDSA-O |
| XLogP | 0.58 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|