C22H27N4O2+ — CID 11931897
2-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]methyl]-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole (PubChem CID 11931897) has the molecular formula C22H27N4O2+ and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]methyl]-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]methyl]-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 11931897 |
| Molecular Formula | C22H27N4O2+ |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]methyl]-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3,4-oxadiazole |
| SMILES | Cc1onc(-c2ccccc2)c1-c1nnc(C[NH+]2CC[C@@H]3CCCC[C@@H]3C2)o1 |
| InChI | InChI=1S/C22H26N4O2/c1-15-20(21(25-28-15)17-8-3-2-4-9-17)22-24-23-19(27-22)14-26-12-11-16-7-5-6-10-18(16)13-26/h2-4,8-9,16,18H,5-7,10-14H2,1H3/p+1/t16-,18+/m0/s1 |
| InChIKey | GHEZEQSOIUMALB-FUHWJXTLSA-O |
| XLogP | 3.30 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |