C10H18N2OS — CID 119319795
(4S)-N-(2-methylcyclopentyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 119319795) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is (4S)-N-(2-methylcyclopentyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-N-(2-methylcyclopentyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119319795 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (4S)-N-(2-methylcyclopentyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1CCCC1NC(=O)[C@H]1CSCN1 |
| InChI | InChI=1S/C10H18N2OS/c1-7-3-2-4-8(7)12-10(13)9-5-14-6-11-9/h7-9,11H,2-6H2,1H3,(H,12,13)/t7?,8?,9-/m1/s1 |
| InChIKey | YZLHDYGPGVLZJN-AMDVSUOASA-N |
| XLogP | 0.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |