C25H40N4O2 — CID 11932124
(2R)-2-[4-[2-(2,3-dimethylanilino)-2-oxoethyl]piperazin-1-yl]-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 11932124) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is (2R)-2-[4-[2-(2,3-dimethylanilino)-2-oxoethyl]piperazin-1-yl]-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[4-[2-(2,3-dimethylanilino)-2-oxoethyl]piperazin-1-yl]-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11932124 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | (2R)-2-[4-[2-(2,3-dimethylanilino)-2-oxoethyl]piperazin-1-yl]-N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | Cc1cccc(NC(=O)CN2CCN([C@H](C)C(=O)N[C@@H]3CCC[C@H](C)[C@@H]3C)CC2)c1C |
| InChI | InChI=1S/C25H40N4O2/c1-17-8-6-10-22(19(17)3)26-24(30)16-28-12-14-29(15-13-28)21(5)25(31)27-23-11-7-9-18(2)20(23)4/h6,8,10,18,20-21,23H,7,9,11-16H2,1-5H3,(H,26,30)(H,27,31)/t18-,20-,21+,23+/m0/s1 |
| InChIKey | JNKIKMFDQOXLPI-VXPBHUBDSA-N |
| XLogP | 3.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |