C10H21ClN2O2 — CID 119322777
4-amino-N-[(2-methyloxolan-2-yl)methyl]butanamide;hydrochloride (PubChem CID 119322777) has the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. Its IUPAC name is 4-amino-N-[(2-methyloxolan-2-yl)methyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[(2-methyloxolan-2-yl)methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119322777 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-amino-N-[(2-methyloxolan-2-yl)methyl]butanamide;hydrochloride |
| SMILES | CC1(CNC(=O)CCCN)CCCO1.Cl |
| InChI | InChI=1S/C10H20N2O2.ClH/c1-10(5-3-7-14-10)8-12-9(13)4-2-6-11;/h2-8,11H2,1H3,(H,12,13);1H |
| InChIKey | FXGHOOIYTSMACI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |