C18H27ClN4O2 — CID 119323783
3-[4-(4-aminobutanoyl)piperazin-1-yl]-1-phenylpyrrolidin-2-one;hydrochloride (PubChem CID 119323783) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 3-[4-(4-aminobutanoyl)piperazin-1-yl]-1-phenylpyrrolidin-2-one;hydrochloride.
| Compound Name | 3-[4-(4-aminobutanoyl)piperazin-1-yl]-1-phenylpyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119323783 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-[4-(4-aminobutanoyl)piperazin-1-yl]-1-phenylpyrrolidin-2-one;hydrochloride |
| SMILES | Cl.NCCCC(=O)N1CCN(C2CCN(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C18H26N4O2.ClH/c19-9-4-7-17(23)21-13-11-20(12-14-21)16-8-10-22(18(16)24)15-5-2-1-3-6-15;/h1-3,5-6,16H,4,7-14,19H2;1H |
| InChIKey | HJWMHRNTJWRINU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |