C18H25N3O2 — CID 119323819
N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]piperidine-2-carboxamide (PubChem CID 119323819) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]piperidine-2-carboxamide.
| Compound Name | N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119323819 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]piperidine-2-carboxamide |
| SMILES | O=C(NCCCC(=O)N1Cc2ccccc2C1)C1CCCCN1 |
| InChI | InChI=1S/C18H25N3O2/c22-17(21-12-14-6-1-2-7-15(14)13-21)9-5-11-20-18(23)16-8-3-4-10-19-16/h1-2,6-7,16,19H,3-5,8-13H2,(H,20,23) |
| InChIKey | PXDLMRJLPRDXAH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|