About 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride
1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride (PubChem CID 119324921) has the molecular formula C16H24ClN3O3S
and a molecular weight of 373.91 g/mol. Its IUPAC name is 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride |
| PubChem CID | 119324921 |
| Molecular Formula | C16H24ClN3O3S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)N(C(=O)C1(N)CCCC1)CC2.Cl |
| InChI | InChI=1S/C16H23N3O3S.ClH/c1-18(2)23(21,22)13-6-5-12-7-10-19(14(12)11-13)15(20)16(17)8-3-4-9-16;/h5-6,11H,3-4,7-10,17H2,1-2H3;1H |
| InChIKey | LFRHMOOTALDNEE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride?
The IUPAC name of 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride (CID 119324921) is 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride.
What is the SMILES notation for 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride?
The canonical SMILES for 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride is CN(C)S(=O)(=O)c1ccc2c(c1)N(C(=O)C1(N)CCCC1)CC2.Cl.
What is the InChIKey of 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride?
The InChIKey is LFRHMOOTALDNEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O3S.ClH/c1-18(2)23(21,22)13-6-5-12-7-10-19(14(12)11-13)15(20)16(17)8-3-4-9-16;/h5-6,11H,3-4,7-10,17H2,1-2H3;1H.
What are the key properties of 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride?
1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride has a molecular weight of 373.91 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-aminocyclopentanecarbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide;hydrochloride is sourced from PubChem (CID 119324921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).