C15H22ClFN2OS — CID 119325004
(2S)-2-amino-N-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-4-methylsulfanylbutanamide (PubChem CID 119325004) has the molecular formula C15H22ClFN2OS and a molecular weight of 332.87 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119325004 |
| Molecular Formula | C15H22ClFN2OS |
| Molecular Weight | 332.87 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (2S)-2-amino-N-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCC(C)(C)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H22ClFN2OS/c1-15(2,11-5-4-10(17)8-12(11)16)9-19-14(20)13(18)6-7-21-3/h4-5,8,13H,6-7,9,18H2,1-3H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | YISHNIHWTRITML-ZDUSSCGKSA-N |
| XLogP | 2.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.87 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |