C13H20N2O — CID 119326216
3-amino-N-[2-(2,6-dimethylphenyl)ethyl]propanamide (PubChem CID 119326216) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-amino-N-[2-(2,6-dimethylphenyl)ethyl]propanamide.
| Compound Name | 3-amino-N-[2-(2,6-dimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 119326216 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-amino-N-[2-(2,6-dimethylphenyl)ethyl]propanamide |
| SMILES | Cc1cccc(C)c1CCNC(=O)CCN |
| InChI | InChI=1S/C13H20N2O/c1-10-4-3-5-11(2)12(10)7-9-15-13(16)6-8-14/h3-5H,6-9,14H2,1-2H3,(H,15,16) |
| InChIKey | FSSRRFQZCJTKLB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |