C18H23NO6S — CID 11932822
dimethyl 5-amino-3-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 11932822) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is dimethyl 5-amino-3-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11932822 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | dimethyl 5-amino-3-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)C[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C18H23NO6S/c1-23-17(21)14-12(15(18(22)24-2)26-16(14)19)8-25-13(20)7-11-6-9-3-4-10(11)5-9/h9-11H,3-8,19H2,1-2H3/t9-,10+,11+/m0/s1 |
| InChIKey | VOOBTVCYBKLTGX-HBNTYKKESA-N |
| XLogP | 2.77 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|