C15H24ClN3O3S — CID 119328489
1-amino-N-[4-(methanesulfonamidomethyl)phenyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119328489) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is 1-amino-N-[4-(methanesulfonamidomethyl)phenyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-[4-(methanesulfonamidomethyl)phenyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119328489 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-amino-N-[4-(methanesulfonamidomethyl)phenyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CS(=O)(=O)NCc1ccc(NC(=O)C2(N)CCCCC2)cc1.Cl |
| InChI | InChI=1S/C15H23N3O3S.ClH/c1-22(20,21)17-11-12-5-7-13(8-6-12)18-14(19)15(16)9-3-2-4-10-15;/h5-8,17H,2-4,9-11,16H2,1H3,(H,18,19);1H |
| InChIKey | ZEHLFMCSAXTOAH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |