C14H20N2O2 — CID 119331766
(2R)-2-amino-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)propanamide (PubChem CID 119331766) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)propanamide.
| Compound Name | (2R)-2-amino-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)propanamide |
|---|---|
| PubChem CID | 119331766 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (2R)-2-amino-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)propanamide |
| SMILES | C[C@@H](N)C(=O)NC1CC(C)(C)Oc2ccccc21 |
| InChI | InChI=1S/C14H20N2O2/c1-9(15)13(17)16-11-8-14(2,3)18-12-7-5-4-6-10(11)12/h4-7,9,11H,8,15H2,1-3H3,(H,16,17)/t9-,11?/m1/s1 |
| InChIKey | XYZZASBPRKZXDO-BFHBGLAWSA-N |
| XLogP | 1.75 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |