C19H28ClN3O2 — CID 119331909
N-[2-[3-(methylcarbamoyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119331909) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is N-[2-[3-(methylcarbamoyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[2-[3-(methylcarbamoyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119331909 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[2-[3-(methylcarbamoyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CNC(=O)c1cccc(CCNC(=O)C2CC3CCCCC3N2)c1.Cl |
| InChI | InChI=1S/C19H27N3O2.ClH/c1-20-18(23)15-7-4-5-13(11-15)9-10-21-19(24)17-12-14-6-2-3-8-16(14)22-17;/h4-5,7,11,14,16-17,22H,2-3,6,8-10,12H2,1H3,(H,20,23)(H,21,24);1H |
| InChIKey | YJPQLAPZWCJGSY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |