C20H31N3O3S — CID 119332388
N-[3-(tert-butylsulfamoyl)-4-methylphenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119332388) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)-4-methylphenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)-4-methylphenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119332388 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)-4-methylphenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC3CCCCC3N2)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H31N3O3S/c1-13-9-10-15(12-18(13)27(25,26)23-20(2,3)4)21-19(24)17-11-14-7-5-6-8-16(14)22-17/h9-10,12,14,16-17,22-23H,5-8,11H2,1-4H3,(H,21,24) |
| InChIKey | FCPLKGHMGIBWKA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |