C17H26Cl2N2O — CID 119332890
N-[1-(4-chlorophenyl)-3-methylbutyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119332890) has the molecular formula C17H26Cl2N2O and a molecular weight of 345.31 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3-methylbutyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-[1-(4-chlorophenyl)-3-methylbutyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119332890 |
| Molecular Formula | C17H26Cl2N2O |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3-methylbutyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | CC(C)CC(NC(=O)C1CCCNC1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C17H25ClN2O.ClH/c1-12(2)10-16(13-5-7-15(18)8-6-13)20-17(21)14-4-3-9-19-11-14;/h5-8,12,14,16,19H,3-4,9-11H2,1-2H3,(H,20,21);1H |
| InChIKey | PAHRGHOMJNYWEQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |