C20H23BrN2O — CID 119333582
(2S)-2-amino-N-[[1-(4-bromophenyl)cyclopropyl]methyl]-N-methyl-3-phenylpropanamide (PubChem CID 119333582) has the molecular formula C20H23BrN2O and a molecular weight of 387.32 g/mol. Its IUPAC name is (2S)-2-amino-N-[[1-(4-bromophenyl)cyclopropyl]methyl]-N-methyl-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[[1-(4-bromophenyl)cyclopropyl]methyl]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 119333582 |
| Molecular Formula | C20H23BrN2O |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (2S)-2-amino-N-[[1-(4-bromophenyl)cyclopropyl]methyl]-N-methyl-3-phenylpropanamide |
| SMILES | CN(CC1(c2ccc(Br)cc2)CC1)C(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C20H23BrN2O/c1-23(19(24)18(22)13-15-5-3-2-4-6-15)14-20(11-12-20)16-7-9-17(21)10-8-16/h2-10,18H,11-14,22H2,1H3/t18-/m0/s1 |
| InChIKey | FYOCSFISUXVIKL-SFHVURJKSA-N |
| XLogP | 3.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |