C18H30N2O2 — CID 119334927
N-(3-ethoxyspiro[3.3]heptan-1-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119334927) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is N-(3-ethoxyspiro[3.3]heptan-1-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-(3-ethoxyspiro[3.3]heptan-1-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119334927 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | N-(3-ethoxyspiro[3.3]heptan-1-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CCOC1CC(NC(=O)C2CC3CCCCC3N2)C12CCC2 |
| InChI | InChI=1S/C18H30N2O2/c1-2-22-16-11-15(18(16)8-5-9-18)20-17(21)14-10-12-6-3-4-7-13(12)19-14/h12-16,19H,2-11H2,1H3,(H,20,21) |
| InChIKey | DCLWYKWUJCIXMZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |