C15H23ClN2O2S — CID 119336127
2-amino-N-[(4-methylsulfanyloxan-4-yl)methyl]-2-phenylacetamide;hydrochloride (PubChem CID 119336127) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is 2-amino-N-[(4-methylsulfanyloxan-4-yl)methyl]-2-phenylacetamide;hydrochloride.
| Compound Name | 2-amino-N-[(4-methylsulfanyloxan-4-yl)methyl]-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119336127 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-amino-N-[(4-methylsulfanyloxan-4-yl)methyl]-2-phenylacetamide;hydrochloride |
| SMILES | CSC1(CNC(=O)C(N)c2ccccc2)CCOCC1.Cl |
| InChI | InChI=1S/C15H22N2O2S.ClH/c1-20-15(7-9-19-10-8-15)11-17-14(18)13(16)12-5-3-2-4-6-12;/h2-6,13H,7-11,16H2,1H3,(H,17,18);1H |
| InChIKey | UVXZFVCGBVCDNV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |