C17H28N2O2S — CID 119339563
(2S)-2-amino-N-[(2-butan-2-yloxy-4-methylphenyl)methyl]-4-methylsulfanylbutanamide (PubChem CID 119339563) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2-butan-2-yloxy-4-methylphenyl)methyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[(2-butan-2-yloxy-4-methylphenyl)methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119339563 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (2S)-2-amino-N-[(2-butan-2-yloxy-4-methylphenyl)methyl]-4-methylsulfanylbutanamide |
| SMILES | CCC(C)Oc1cc(C)ccc1CNC(=O)[C@@H](N)CCSC |
| InChI | InChI=1S/C17H28N2O2S/c1-5-13(3)21-16-10-12(2)6-7-14(16)11-19-17(20)15(18)8-9-22-4/h6-7,10,13,15H,5,8-9,11,18H2,1-4H3,(H,19,20)/t13?,15-/m0/s1 |
| InChIKey | ABPADMZYGDEUJB-WUJWULDRSA-N |
| XLogP | 2.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |