C20H25ClN2O3 — CID 119340201
2-amino-N-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methyl]-2-phenylacetamide;hydrochloride (PubChem CID 119340201) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is 2-amino-N-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methyl]-2-phenylacetamide;hydrochloride.
| Compound Name | 2-amino-N-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methyl]-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119340201 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-amino-N-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methyl]-2-phenylacetamide;hydrochloride |
| SMILES | Cc1ccc(CNC(=O)C(N)c2ccccc2)c(OC2CCOC2)c1.Cl |
| InChI | InChI=1S/C20H24N2O3.ClH/c1-14-7-8-16(18(11-14)25-17-9-10-24-13-17)12-22-20(23)19(21)15-5-3-2-4-6-15;/h2-8,11,17,19H,9-10,12-13,21H2,1H3,(H,22,23);1H |
| InChIKey | XGRKLSOUTJXHQB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |