C19H25ClN2O4S — CID 119340507
2-amino-N-[4-(2-ethylsulfonylphenoxy)phenyl]pentanamide;hydrochloride (PubChem CID 119340507) has the molecular formula C19H25ClN2O4S and a molecular weight of 412.94 g/mol. Its IUPAC name is 2-amino-N-[4-(2-ethylsulfonylphenoxy)phenyl]pentanamide;hydrochloride.
| Compound Name | 2-amino-N-[4-(2-ethylsulfonylphenoxy)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119340507 |
| Molecular Formula | C19H25ClN2O4S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-amino-N-[4-(2-ethylsulfonylphenoxy)phenyl]pentanamide;hydrochloride |
| SMILES | CCCC(N)C(=O)Nc1ccc(Oc2ccccc2S(=O)(=O)CC)cc1.Cl |
| InChI | InChI=1S/C19H24N2O4S.ClH/c1-3-7-16(20)19(22)21-14-10-12-15(13-11-14)25-17-8-5-6-9-18(17)26(23,24)4-2;/h5-6,8-13,16H,3-4,7,20H2,1-2H3,(H,21,22);1H |
| InChIKey | ZFXLQARFNKCCEC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |