C19H23FN2O2 — CID 119340597
(2S)-2-amino-N-[2-(2-fluorophenoxy)butyl]-3-phenylpropanamide (PubChem CID 119340597) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(2-fluorophenoxy)butyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[2-(2-fluorophenoxy)butyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 119340597 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2S)-2-amino-N-[2-(2-fluorophenoxy)butyl]-3-phenylpropanamide |
| SMILES | CCC(CNC(=O)[C@@H](N)Cc1ccccc1)Oc1ccccc1F |
| InChI | InChI=1S/C19H23FN2O2/c1-2-15(24-18-11-7-6-10-16(18)20)13-22-19(23)17(21)12-14-8-4-3-5-9-14/h3-11,15,17H,2,12-13,21H2,1H3,(H,22,23)/t15?,17-/m0/s1 |
| InChIKey | NAIDJWDVJAPNLI-LWKPJOBUSA-N |
| XLogP | 2.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |