C19H26N2O5S — CID 119341398
ethyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-5-methylsulfonylbenzoate (PubChem CID 119341398) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is ethyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-5-methylsulfonylbenzoate.
| Compound Name | ethyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 119341398 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | ethyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-5-methylsulfonylbenzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)C2CC3CCCCC3N2)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H26N2O5S/c1-3-26-19(23)13-8-14(11-15(9-13)27(2,24)25)20-18(22)17-10-12-6-4-5-7-16(12)21-17/h8-9,11-12,16-17,21H,3-7,10H2,1-2H3,(H,20,22) |
| InChIKey | NZZSIHHROXBMNV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |