C17H26ClN3O3 — CID 119342431
N-[5-(dimethylcarbamoyl)-2-ethoxyphenyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119342431) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is N-[5-(dimethylcarbamoyl)-2-ethoxyphenyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-[5-(dimethylcarbamoyl)-2-ethoxyphenyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119342431 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[5-(dimethylcarbamoyl)-2-ethoxyphenyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | CCOc1ccc(C(=O)N(C)C)cc1NC(=O)C1CCCNC1.Cl |
| InChI | InChI=1S/C17H25N3O3.ClH/c1-4-23-15-8-7-12(17(22)20(2)3)10-14(15)19-16(21)13-6-5-9-18-11-13;/h7-8,10,13,18H,4-6,9,11H2,1-3H3,(H,19,21);1H |
| InChIKey | GMWKNCGPPOAGLD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |