About 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride
4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride (PubChem CID 119342989) has the molecular formula C13H27ClN2O2
and a molecular weight of 278.82 g/mol. Its IUPAC name is 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride.
Molecular Properties
| Compound Name | 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride |
| PubChem CID | 119342989 |
| Molecular Formula | C13H27ClN2O2 |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride |
| SMILES | COC1(C)CC(N(C)C(=O)CCCN)C1(C)C.Cl |
| InChI | InChI=1S/C13H26N2O2.ClH/c1-12(2)10(9-13(12,3)17-5)15(4)11(16)7-6-8-14;/h10H,6-9,14H2,1-5H3;1H |
| InChIKey | LUVFTQYRWVRIBH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride?
The IUPAC name of 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride (CID 119342989) is 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride.
What is the SMILES notation for 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride?
The canonical SMILES for 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride is COC1(C)CC(N(C)C(=O)CCCN)C1(C)C.Cl.
What is the InChIKey of 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride?
The InChIKey is LUVFTQYRWVRIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2.ClH/c1-12(2)10(9-13(12,3)17-5)15(4)11(16)7-6-8-14;/h10H,6-9,14H2,1-5H3;1H.
What are the key properties of 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride?
4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride has a molecular weight of 278.82 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylbutanamide;hydrochloride is sourced from PubChem (CID 119342989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).