C13H17F3N2O — CID 119344001
4-amino-N-[2-(3,3,3-trifluoropropyl)phenyl]butanamide (PubChem CID 119344001) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-amino-N-[2-(3,3,3-trifluoropropyl)phenyl]butanamide.
| Compound Name | 4-amino-N-[2-(3,3,3-trifluoropropyl)phenyl]butanamide |
|---|---|
| PubChem CID | 119344001 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-amino-N-[2-(3,3,3-trifluoropropyl)phenyl]butanamide |
| SMILES | NCCCC(=O)Nc1ccccc1CCC(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O/c14-13(15,16)8-7-10-4-1-2-5-11(10)18-12(19)6-3-9-17/h1-2,4-5H,3,6-9,17H2,(H,18,19) |
| InChIKey | NJWFWMFLQJMGGT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |