About (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride
(2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride (PubChem CID 119344939) has the molecular formula C11H20ClN3O2
and a molecular weight of 261.75 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride |
| PubChem CID | 119344939 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride |
| SMILES | CCc1noc(CC)c1CNC(=O)[C@H](C)N.Cl |
| InChI | InChI=1S/C11H19N3O2.ClH/c1-4-9-8(10(5-2)16-14-9)6-13-11(15)7(3)12;/h7H,4-6,12H2,1-3H3,(H,13,15);1H/t7-;/m0./s1 |
| InChIKey | ARPGSYWZFQOHAS-FJXQXJEOSA-N |
| XLogP | 1.18 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride?
The IUPAC name of (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride (CID 119344939) is (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride.
What is the SMILES notation for (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride?
The canonical SMILES for (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride is CCc1noc(CC)c1CNC(=O)[C@H](C)N.Cl.
What is the InChIKey of (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride?
The InChIKey is ARPGSYWZFQOHAS-FJXQXJEOSA-N. The full InChI is InChI=1S/C11H19N3O2.ClH/c1-4-9-8(10(5-2)16-14-9)6-13-11(15)7(3)12;/h7H,4-6,12H2,1-3H3,(H,13,15);1H/t7-;/m0./s1.
What are the key properties of (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride?
(2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride has a molecular weight of 261.75 g/mol, XLogP of 1.18, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]propanamide;hydrochloride is sourced from PubChem (CID 119344939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).