C16H27ClN2O — CID 119345467
2-amino-N-(2,2-diethylbutyl)-2-phenylacetamide;hydrochloride (PubChem CID 119345467) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is 2-amino-N-(2,2-diethylbutyl)-2-phenylacetamide;hydrochloride.
| Compound Name | 2-amino-N-(2,2-diethylbutyl)-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119345467 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-amino-N-(2,2-diethylbutyl)-2-phenylacetamide;hydrochloride |
| SMILES | CCC(CC)(CC)CNC(=O)C(N)c1ccccc1.Cl |
| InChI | InChI=1S/C16H26N2O.ClH/c1-4-16(5-2,6-3)12-18-15(19)14(17)13-10-8-7-9-11-13;/h7-11,14H,4-6,12,17H2,1-3H3,(H,18,19);1H |
| InChIKey | IAEYASBPQRFEQE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |