C18H23ClN2O4 — CID 119345843
4-(aminomethyl)-N-[2-(3,5-dimethoxyphenoxy)ethyl]benzamide;hydrochloride (PubChem CID 119345843) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-(3,5-dimethoxyphenoxy)ethyl]benzamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-[2-(3,5-dimethoxyphenoxy)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119345843 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 4-(aminomethyl)-N-[2-(3,5-dimethoxyphenoxy)ethyl]benzamide;hydrochloride |
| SMILES | COc1cc(OC)cc(OCCNC(=O)c2ccc(CN)cc2)c1.Cl |
| InChI | InChI=1S/C18H22N2O4.ClH/c1-22-15-9-16(23-2)11-17(10-15)24-8-7-20-18(21)14-5-3-13(12-19)4-6-14;/h3-6,9-11H,7-8,12,19H2,1-2H3,(H,20,21);1H |
| InChIKey | YQIJLRQQVZKISC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|