C17H32N3S+ — CID 11934641
[1-[[[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]methyl]cyclohexyl]-dimethylazanium (PubChem CID 11934641) has the molecular formula C17H32N3S+ and a molecular weight of 310.53 g/mol. Its IUPAC name is [1-[[[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]methyl]cyclohexyl]-dimethylazanium.
| Compound Name | [1-[[[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]methyl]cyclohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 11934641 |
| Molecular Formula | C17H32N3S+ |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | [1-[[[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioylamino]methyl]cyclohexyl]-dimethylazanium |
| SMILES | C[NH+](C)C1(CNC(=S)N[C@H]2C[C@H]3CC[C@@H]2C3)CCCCC1 |
| InChI | InChI=1S/C17H31N3S/c1-20(2)17(8-4-3-5-9-17)12-18-16(21)19-15-11-13-6-7-14(15)10-13/h13-15H,3-12H2,1-2H3,(H2,18,19,21)/p+1/t13-,14+,15-/m0/s1 |
| InChIKey | ZRCHVVUEFSLPRW-ZNMIVQPWSA-O |
| XLogP | 1.49 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|