C12H19N3S — CID 11934669
3-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-cyanoethyl)-1-methylthiourea (PubChem CID 11934669) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-cyanoethyl)-1-methylthiourea.
| Compound Name | 3-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-cyanoethyl)-1-methylthiourea |
|---|---|
| PubChem CID | 11934669 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-cyanoethyl)-1-methylthiourea |
| SMILES | CN(CCC#N)C(=S)N[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C12H19N3S/c1-15(6-2-5-13)12(16)14-11-8-9-3-4-10(11)7-9/h9-11H,2-4,6-8H2,1H3,(H,14,16)/t9-,10+,11-/m0/s1 |
| InChIKey | UOKGBAIBFTUFTB-AXFHLTTASA-N |
| XLogP | 1.89 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|