C15H16N2O5 — CID 119346844
4-[[6-(furan-2-yl)-2-oxo-1H-pyridine-3-carbonyl]-methylamino]butanoic acid (PubChem CID 119346844) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 4-[[6-(furan-2-yl)-2-oxo-1H-pyridine-3-carbonyl]-methylamino]butanoic acid.
| Compound Name | 4-[[6-(furan-2-yl)-2-oxo-1H-pyridine-3-carbonyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119346844 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-[[6-(furan-2-yl)-2-oxo-1H-pyridine-3-carbonyl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)c1ccc(-c2ccco2)[nH]c1=O |
| InChI | InChI=1S/C15H16N2O5/c1-17(8-2-5-13(18)19)15(21)10-6-7-11(16-14(10)20)12-4-3-9-22-12/h3-4,6-7,9H,2,5,8H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | GTNXOHUNRJXFEL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |