About 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid
4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid (PubChem CID 119347007) has the molecular formula C15H21NO4S
and a molecular weight of 311.40 g/mol. Its IUPAC name is 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid.
Molecular Properties
| Compound Name | 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid |
| PubChem CID | 119347007 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid |
| SMILES | Cc1cc(C(=O)CCC(=O)N(C)CCCC(=O)O)c(C)s1 |
| InChI | InChI=1S/C15H21NO4S/c1-10-9-12(11(2)21-10)13(17)6-7-14(18)16(3)8-4-5-15(19)20/h9H,4-8H2,1-3H3,(H,19,20) |
| InChIKey | IRPXDBVWDZQLBI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid?
The IUPAC name of 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid (CID 119347007) is 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid.
What is the SMILES notation for 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid?
The canonical SMILES for 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid is Cc1cc(C(=O)CCC(=O)N(C)CCCC(=O)O)c(C)s1.
What is the InChIKey of 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid?
The InChIKey is IRPXDBVWDZQLBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4S/c1-10-9-12(11(2)21-10)13(17)6-7-14(18)16(3)8-4-5-15(19)20/h9H,4-8H2,1-3H3,(H,19,20).
What are the key properties of 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid?
4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid has a molecular weight of 311.40 g/mol, XLogP of 2.65, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-methylamino]butanoic acid is sourced from PubChem (CID 119347007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).