C17H30N3O2+ — CID 11934751
[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium (PubChem CID 11934751) has the molecular formula C17H30N3O2+ and a molecular weight of 308.45 g/mol. Its IUPAC name is [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 11934751 |
| Molecular Formula | C17H30N3O2+ |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | [2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NC1CC1)CC(=O)N1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C17H29N3O2/c1-19(11-16(21)18-15-6-7-15)12-17(22)20-9-8-13-4-2-3-5-14(13)10-20/h13-15H,2-12H2,1H3,(H,18,21)/p+1/t13-,14-/m1/s1 |
| InChIKey | XXEGDAINSKARAR-ZIAGYGMSSA-O |
| XLogP | -0.18 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |