C13H16INO4 — CID 119348042
2-[[2-(3-iodophenyl)acetyl]-(2-methoxyethyl)amino]acetic acid (PubChem CID 119348042) has the molecular formula C13H16INO4 and a molecular weight of 377.18 g/mol. Its IUPAC name is 2-[[2-(3-iodophenyl)acetyl]-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[[2-(3-iodophenyl)acetyl]-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 119348042 |
| Molecular Formula | C13H16INO4 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2-[[2-(3-iodophenyl)acetyl]-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)Cc1cccc(I)c1 |
| InChI | InChI=1S/C13H16INO4/c1-19-6-5-15(9-13(17)18)12(16)8-10-3-2-4-11(14)7-10/h2-4,7H,5-6,8-9H2,1H3,(H,17,18) |
| InChIKey | JPYCXUBKZFXCPC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|