C15H16N4O6 — CID 119348205
2-[(4-imidazol-1-yl-3-nitrobenzoyl)-(2-methoxyethyl)amino]acetic acid (PubChem CID 119348205) has the molecular formula C15H16N4O6 and a molecular weight of 348.31 g/mol. Its IUPAC name is 2-[(4-imidazol-1-yl-3-nitrobenzoyl)-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[(4-imidazol-1-yl-3-nitrobenzoyl)-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 119348205 |
| Molecular Formula | C15H16N4O6 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[(4-imidazol-1-yl-3-nitrobenzoyl)-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16N4O6/c1-25-7-6-17(9-14(20)21)15(22)11-2-3-12(13(8-11)19(23)24)18-5-4-16-10-18/h2-5,8,10H,6-7,9H2,1H3,(H,20,21) |
| InChIKey | XGRUXLLVTJFZNI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|