C14H21N3O5 — CID 119348552
2-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]propanoic acid (PubChem CID 119348552) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119348552 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)CN1C(=O)NC2(CCCCC2C)C1=O)C(=O)O |
| InChI | InChI=1S/C14H21N3O5/c1-8-5-3-4-6-14(8)12(21)17(13(22)16-14)7-10(18)15-9(2)11(19)20/h8-9H,3-7H2,1-2H3,(H,15,18)(H,16,22)(H,19,20) |
| InChIKey | RZCQOEUZFXAUGY-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|