C16H19ClN2O4 — CID 119349897
1-[2-[(4-chlorobenzoyl)amino]propanoyl]piperidine-4-carboxylic acid (PubChem CID 119349897) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is 1-[2-[(4-chlorobenzoyl)amino]propanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[(4-chlorobenzoyl)amino]propanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119349897 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-[2-[(4-chlorobenzoyl)amino]propanoyl]piperidine-4-carboxylic acid |
| SMILES | CC(NC(=O)c1ccc(Cl)cc1)C(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H19ClN2O4/c1-10(18-14(20)11-2-4-13(17)5-3-11)15(21)19-8-6-12(7-9-19)16(22)23/h2-5,10,12H,6-9H2,1H3,(H,18,20)(H,22,23) |
| InChIKey | ZMROONDQGCLTQA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |