C16H20FN3O4 — CID 119350889
3-[[1-[(2-fluorophenyl)carbamoyl]piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 119350889) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is 3-[[1-[(2-fluorophenyl)carbamoyl]piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[1-[(2-fluorophenyl)carbamoyl]piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119350889 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-[[1-[(2-fluorophenyl)carbamoyl]piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C1CCCN(C(=O)Nc2ccccc2F)C1 |
| InChI | InChI=1S/C16H20FN3O4/c17-12-5-1-2-6-13(12)19-16(24)20-9-3-4-11(10-20)15(23)18-8-7-14(21)22/h1-2,5-6,11H,3-4,7-10H2,(H,18,23)(H,19,24)(H,21,22) |
| InChIKey | NBZYKKVVRFKAGM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |