C22H24N2O5 — CID 119352027
2-[3-[[1-(2-phenoxyacetyl)piperidine-3-carbonyl]amino]phenyl]acetic acid (PubChem CID 119352027) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[3-[[1-(2-phenoxyacetyl)piperidine-3-carbonyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-[[1-(2-phenoxyacetyl)piperidine-3-carbonyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 119352027 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[3-[[1-(2-phenoxyacetyl)piperidine-3-carbonyl]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(NC(=O)C2CCCN(C(=O)COc3ccccc3)C2)c1 |
| InChI | InChI=1S/C22H24N2O5/c25-20(15-29-19-9-2-1-3-10-19)24-11-5-7-17(14-24)22(28)23-18-8-4-6-16(12-18)13-21(26)27/h1-4,6,8-10,12,17H,5,7,11,13-15H2,(H,23,28)(H,26,27) |
| InChIKey | LIPVSVUOUFZKTC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |